C9H5Cl2N3O3 — CID 46398536
7-chloro-2-(chloromethyl)-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 46398536) has the molecular formula C9H5Cl2N3O3 and a molecular weight of 274.06 g/mol. Its IUPAC name is 7-chloro-2-(chloromethyl)-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 7-chloro-2-(chloromethyl)-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 46398536 |
| Molecular Formula | C9H5Cl2N3O3 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 7-chloro-2-(chloromethyl)-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(CCl)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C9H5Cl2N3O3/c10-3-6-8(14(16)17)9(15)13-4-5(11)1-2-7(13)12-6/h1-2,4H,3H2 |
| InChIKey | FVYKVOQRZZKJIN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|