C14H9ClN4O3S — CID 7259463
7-chloro-2-[(3-nitrophenyl)methylsulfanyl]pyrido[1,2-a][1,3,5]triazin-4-one (PubChem CID 7259463) has the molecular formula C14H9ClN4O3S and a molecular weight of 348.77 g/mol. Its IUPAC name is 7-chloro-2-[(3-nitrophenyl)methylsulfanyl]pyrido[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 7-chloro-2-[(3-nitrophenyl)methylsulfanyl]pyrido[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 7259463 |
| Molecular Formula | C14H9ClN4O3S |
| Molecular Weight | 348.77 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 7-chloro-2-[(3-nitrophenyl)methylsulfanyl]pyrido[1,2-a][1,3,5]triazin-4-one |
| SMILES | O=c1nc(SCc2cccc([N+](=O)[O-])c2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C14H9ClN4O3S/c15-10-4-5-12-16-13(17-14(20)18(12)7-10)23-8-9-2-1-3-11(6-9)19(21)22/h1-7H,8H2 |
| InChIKey | BKQHCLFKUMDVOG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|