C21H16ClN3O3S2 — CID 4139205
3-[2-(4-chlorophenyl)ethyl]-2-[(3-nitrophenyl)methylsulfanyl]thieno[3,2-d]pyrimidin-4-one (PubChem CID 4139205) has the molecular formula C21H16ClN3O3S2 and a molecular weight of 457.96 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)ethyl]-2-[(3-nitrophenyl)methylsulfanyl]thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[2-(4-chlorophenyl)ethyl]-2-[(3-nitrophenyl)methylsulfanyl]thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4139205 |
| Molecular Formula | C21H16ClN3O3S2 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 3-[2-(4-chlorophenyl)ethyl]-2-[(3-nitrophenyl)methylsulfanyl]thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2nc(SCc2cccc([N+](=O)[O-])c2)n1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClN3O3S2/c22-16-6-4-14(5-7-16)8-10-24-20(26)19-18(9-11-29-19)23-21(24)30-13-15-2-1-3-17(12-15)25(27)28/h1-7,9,11-12H,8,10,13H2 |
| InChIKey | SNEWVBHVPLNZNX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|