C25H22N4O6S2 — CID 5020051
N-(1,3-benzodioxol-5-ylmethyl)-4-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxothieno[3,2-d]pyrimidin-3-yl]butanamide (PubChem CID 5020051) has the molecular formula C25H22N4O6S2 and a molecular weight of 538.61 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxothieno[3,2-d]pyrimidin-3-yl]butanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxothieno[3,2-d]pyrimidin-3-yl]butanamide |
|---|---|
| PubChem CID | 5020051 |
| Molecular Formula | C25H22N4O6S2 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[2-[(3-nitrophenyl)methylsulfanyl]-4-oxothieno[3,2-d]pyrimidin-3-yl]butanamide |
| SMILES | O=C(CCCn1c(SCc2cccc([N+](=O)[O-])c2)nc2ccsc2c1=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H22N4O6S2/c30-22(26-13-16-6-7-20-21(12-16)35-15-34-20)5-2-9-28-24(31)23-19(8-10-36-23)27-25(28)37-14-17-3-1-4-18(11-17)29(32)33/h1,3-4,6-8,10-12H,2,5,9,13-15H2,(H,26,30) |
| InChIKey | JJQPHVFFFOXKPV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|