C28H26N4O7S — CID 5213389
N-[(4-methoxyphenyl)methyl]-4-[6-[(4-nitrophenyl)methylsulfanyl]-8-oxo-[1,3]dioxolo[4,5-g]quinazolin-7-yl]butanamide (PubChem CID 5213389) has the molecular formula C28H26N4O7S and a molecular weight of 562.60 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-4-[6-[(4-nitrophenyl)methylsulfanyl]-8-oxo-[1,3]dioxolo[4,5-g]quinazolin-7-yl]butanamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-4-[6-[(4-nitrophenyl)methylsulfanyl]-8-oxo-[1,3]dioxolo[4,5-g]quinazolin-7-yl]butanamide |
|---|---|
| PubChem CID | 5213389 |
| Molecular Formula | C28H26N4O7S |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-4-[6-[(4-nitrophenyl)methylsulfanyl]-8-oxo-[1,3]dioxolo[4,5-g]quinazolin-7-yl]butanamide |
| SMILES | COc1ccc(CNC(=O)CCCn2c(SCc3ccc([N+](=O)[O-])cc3)nc3cc4c(cc3c2=O)OCO4)cc1 |
| InChI | InChI=1S/C28H26N4O7S/c1-37-21-10-6-18(7-11-21)15-29-26(33)3-2-12-31-27(34)22-13-24-25(39-17-38-24)14-23(22)30-28(31)40-16-19-4-8-20(9-5-19)32(35)36/h4-11,13-14H,2-3,12,15-17H2,1H3,(H,29,33) |
| InChIKey | WOOWQBGNGOSQHO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|