C32H34N4O8S — CID 46370041
N-[2-(3,4-dimethoxyphenyl)ethyl]-6-[6-[(3-nitrophenyl)methylsulfanyl]-8-oxo-[1,3]dioxolo[4,5-g]quinazolin-7-yl]hexanamide (PubChem CID 46370041) has the molecular formula C32H34N4O8S and a molecular weight of 634.71 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-6-[6-[(3-nitrophenyl)methylsulfanyl]-8-oxo-[1,3]dioxolo[4,5-g]quinazolin-7-yl]hexanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-6-[6-[(3-nitrophenyl)methylsulfanyl]-8-oxo-[1,3]dioxolo[4,5-g]quinazolin-7-yl]hexanamide |
|---|---|
| PubChem CID | 46370041 |
| Molecular Formula | C32H34N4O8S |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-6-[6-[(3-nitrophenyl)methylsulfanyl]-8-oxo-[1,3]dioxolo[4,5-g]quinazolin-7-yl]hexanamide |
| SMILES | COc1ccc(CCNC(=O)CCCCCn2c(SCc3cccc([N+](=O)[O-])c3)nc3cc4c(cc3c2=O)OCO4)cc1OC |
| InChI | InChI=1S/C32H34N4O8S/c1-41-26-11-10-21(16-27(26)42-2)12-13-33-30(37)9-4-3-5-14-35-31(38)24-17-28-29(44-20-43-28)18-25(24)34-32(35)45-19-22-7-6-8-23(15-22)36(39)40/h6-8,10-11,15-18H,3-5,9,12-14,19-20H2,1-2H3,(H,33,37) |
| InChIKey | PGFVYOFXZXHUJP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|