C27H26ClN3O5S — CID 22428168
N-(1,3-benzodioxol-5-ylmethyl)-6-[1-[(3-chlorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide (PubChem CID 22428168) has the molecular formula C27H26ClN3O5S and a molecular weight of 540.04 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-6-[1-[(3-chlorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[1-[(3-chlorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 22428168 |
| Molecular Formula | C27H26ClN3O5S |
| Molecular Weight | 540.04 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[1-[(3-chlorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide |
| SMILES | O=C(CCCCCn1c(=O)c2sccc2n(Cc2cccc(Cl)c2)c1=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H26ClN3O5S/c28-20-6-4-5-19(13-20)16-31-21-10-12-37-25(21)26(33)30(27(31)34)11-3-1-2-7-24(32)29-15-18-8-9-22-23(14-18)36-17-35-22/h4-6,8-10,12-14H,1-3,7,11,15-17H2,(H,29,32) |
| InChIKey | JCIMAPHRCLXYAG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.04 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|