C26H31N3O6S — CID 15989111
N-(1,3-benzodioxol-5-ylmethyl)-6-[1-(3,3-dimethyl-2-oxobutyl)-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide (PubChem CID 15989111) has the molecular formula C26H31N3O6S and a molecular weight of 513.62 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-6-[1-(3,3-dimethyl-2-oxobutyl)-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[1-(3,3-dimethyl-2-oxobutyl)-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 15989111 |
| Molecular Formula | C26H31N3O6S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[1-(3,3-dimethyl-2-oxobutyl)-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide |
| SMILES | CC(C)(C)C(=O)Cn1c(=O)n(CCCCCC(=O)NCc2ccc3c(c2)OCO3)c(=O)c2sccc21 |
| InChI | InChI=1S/C26H31N3O6S/c1-26(2,3)21(30)15-29-18-10-12-36-23(18)24(32)28(25(29)33)11-6-4-5-7-22(31)27-14-17-8-9-19-20(13-17)35-16-34-19/h8-10,12-13H,4-7,11,14-16H2,1-3H3,(H,27,31) |
| InChIKey | GQFAZVODAQPZDB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|