C32H35N5O6S — CID 46246516
N-(1,3-benzodioxol-5-ylmethyl)-6-[2,4-dioxo-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]thieno[3,2-d]pyrimidin-3-yl]hexanamide (PubChem CID 46246516) has the molecular formula C32H35N5O6S and a molecular weight of 617.73 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-6-[2,4-dioxo-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]thieno[3,2-d]pyrimidin-3-yl]hexanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[2,4-dioxo-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]thieno[3,2-d]pyrimidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 46246516 |
| Molecular Formula | C32H35N5O6S |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-6-[2,4-dioxo-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]thieno[3,2-d]pyrimidin-3-yl]hexanamide |
| SMILES | O=C(CCCCCn1c(=O)c2sccc2n(CC(=O)N2CCN(c3ccccc3)CC2)c1=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H35N5O6S/c38-28(33-20-23-10-11-26-27(19-23)43-22-42-26)9-5-2-6-13-36-31(40)30-25(12-18-44-30)37(32(36)41)21-29(39)35-16-14-34(15-17-35)24-7-3-1-4-8-24/h1,3-4,7-8,10-12,18-19H,2,5-6,9,13-17,20-22H2,(H,33,38) |
| InChIKey | YYBJWXPDKBNDEK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|