C26H26FN3O3S — CID 22428299
N-benzyl-6-[1-[(3-fluorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide (PubChem CID 22428299) has the molecular formula C26H26FN3O3S and a molecular weight of 479.58 g/mol. Its IUPAC name is N-benzyl-6-[1-[(3-fluorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide.
| Compound Name | N-benzyl-6-[1-[(3-fluorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 22428299 |
| Molecular Formula | C26H26FN3O3S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-benzyl-6-[1-[(3-fluorophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide |
| SMILES | O=C(CCCCCn1c(=O)c2sccc2n(Cc2cccc(F)c2)c1=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H26FN3O3S/c27-21-11-7-10-20(16-21)18-30-22-13-15-34-24(22)25(32)29(26(30)33)14-6-2-5-12-23(31)28-17-19-8-3-1-4-9-19/h1,3-4,7-11,13,15-16H,2,5-6,12,14,17-18H2,(H,28,31) |
| InChIKey | IMRLHFUDPLFIEJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|