C28H28FN3O5S — CID 18559113
N-[(4-fluorophenyl)methyl]-6-[1-[(5-formyl-2-methoxyphenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide (PubChem CID 18559113) has the molecular formula C28H28FN3O5S and a molecular weight of 537.61 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6-[1-[(5-formyl-2-methoxyphenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-6-[1-[(5-formyl-2-methoxyphenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 18559113 |
| Molecular Formula | C28H28FN3O5S |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6-[1-[(5-formyl-2-methoxyphenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide |
| SMILES | COc1ccc(C=O)cc1Cn1c(=O)n(CCCCCC(=O)NCc2ccc(F)cc2)c(=O)c2sccc21 |
| InChI | InChI=1S/C28H28FN3O5S/c1-37-24-11-8-20(18-33)15-21(24)17-32-23-12-14-38-26(23)27(35)31(28(32)36)13-4-2-3-5-25(34)30-16-19-6-9-22(29)10-7-19/h6-12,14-15,18H,2-5,13,16-17H2,1H3,(H,30,34) |
| InChIKey | OSJFRSIHTGNLNK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|