C26H25ClN4O5S — CID 46246501
N-[(2-chlorophenyl)methyl]-6-[1-[(3-nitrophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide (PubChem CID 46246501) has the molecular formula C26H25ClN4O5S and a molecular weight of 541.03 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-6-[1-[(3-nitrophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-6-[1-[(3-nitrophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 46246501 |
| Molecular Formula | C26H25ClN4O5S |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-6-[1-[(3-nitrophenyl)methyl]-2,4-dioxothieno[3,2-d]pyrimidin-3-yl]hexanamide |
| SMILES | O=C(CCCCCn1c(=O)c2sccc2n(Cc2cccc([N+](=O)[O-])c2)c1=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C26H25ClN4O5S/c27-21-10-4-3-8-19(21)16-28-23(32)11-2-1-5-13-29-25(33)24-22(12-14-37-24)30(26(29)34)17-18-7-6-9-20(15-18)31(35)36/h3-4,6-10,12,14-15H,1-2,5,11,13,16-17H2,(H,28,32) |
| InChIKey | NIKUXKFSTNRNQP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|