C19H20ClN3O2S2 — CID 3269971
N-[(2-chlorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)hexanamide (PubChem CID 3269971) has the molecular formula C19H20ClN3O2S2 and a molecular weight of 421.98 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)hexanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)hexanamide |
|---|---|
| PubChem CID | 3269971 |
| Molecular Formula | C19H20ClN3O2S2 |
| Molecular Weight | 421.98 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-6-(4-oxo-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-3-yl)hexanamide |
| SMILES | O=C(CCCCCn1c(=S)[nH]c2ccsc2c1=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C19H20ClN3O2S2/c20-14-7-4-3-6-13(14)12-21-16(24)8-2-1-5-10-23-18(25)17-15(9-11-27-17)22-19(23)26/h3-4,6-7,9,11H,1-2,5,8,10,12H2,(H,21,24)(H,22,26) |
| InChIKey | APURDGWQDRYINH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.98 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|