C20H22N4O2S2 — CID 5192175
3-[4-oxo-4-(4-phenylpiperazin-1-yl)butyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 5192175) has the molecular formula C20H22N4O2S2 and a molecular weight of 414.56 g/mol. Its IUPAC name is 3-[4-oxo-4-(4-phenylpiperazin-1-yl)butyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[4-oxo-4-(4-phenylpiperazin-1-yl)butyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 5192175 |
| Molecular Formula | C20H22N4O2S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 3-[4-oxo-4-(4-phenylpiperazin-1-yl)butyl]-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=C(CCCn1c(=S)[nH]c2ccsc2c1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N4O2S2/c25-17(23-12-10-22(11-13-23)15-5-2-1-3-6-15)7-4-9-24-19(26)18-16(8-14-28-18)21-20(24)27/h1-3,5-6,8,14H,4,7,9-13H2,(H,21,27) |
| InChIKey | BHLIBMXYOUGAOW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|