C24H30N4O3S — CID 16811812
3-[6-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-oxohexyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 16811812) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is 3-[6-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-oxohexyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-[6-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-oxohexyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 16811812 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 3-[6-[4-(2,5-dimethylphenyl)piperazin-1-yl]-6-oxohexyl]-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)CCCCCn3c(=O)[nH]c4ccsc4c3=O)CC2)c1 |
| InChI | InChI=1S/C24H30N4O3S/c1-17-7-8-18(2)20(16-17)26-11-13-27(14-12-26)21(29)6-4-3-5-10-28-23(30)22-19(9-15-32-22)25-24(28)31/h7-9,15-16H,3-6,10-14H2,1-2H3,(H,25,31) |
| InChIKey | PMBKHGUOYBKSGP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|