C21H25N3O3S — CID 22423579
6-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-[2-(4-methylphenyl)ethyl]hexanamide (PubChem CID 22423579) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 6-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-[2-(4-methylphenyl)ethyl]hexanamide.
| Compound Name | 6-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-[2-(4-methylphenyl)ethyl]hexanamide |
|---|---|
| PubChem CID | 22423579 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 6-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-[2-(4-methylphenyl)ethyl]hexanamide |
| SMILES | Cc1ccc(CCNC(=O)CCCCCn2c(=O)[nH]c3ccsc3c2=O)cc1 |
| InChI | InChI=1S/C21H25N3O3S/c1-15-6-8-16(9-7-15)10-12-22-18(25)5-3-2-4-13-24-20(26)19-17(11-14-28-19)23-21(24)27/h6-9,11,14H,2-5,10,12-13H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | WLTAVBDIHXCZLN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|