C10H9F3N2OS2 — CID 115520994
2-sulfanylidene-3-(4,4,4-trifluorobutyl)-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 115520994) has the molecular formula C10H9F3N2OS2 and a molecular weight of 294.32 g/mol. Its IUPAC name is 2-sulfanylidene-3-(4,4,4-trifluorobutyl)-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-3-(4,4,4-trifluorobutyl)-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 115520994 |
| Molecular Formula | C10H9F3N2OS2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-sulfanylidene-3-(4,4,4-trifluorobutyl)-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2[nH]c(=S)n1CCCC(F)(F)F |
| InChI | InChI=1S/C10H9F3N2OS2/c11-10(12,13)3-1-4-15-8(16)7-6(2-5-18-7)14-9(15)17/h2,5H,1,3-4H2,(H,14,17) |
| InChIKey | XAKLOGLZMCZUQX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|