C11H9N3OS3 — CID 63825689
2-sulfanylidene-3-[2-(1,3-thiazol-4-yl)ethyl]-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 63825689) has the molecular formula C11H9N3OS3 and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-sulfanylidene-3-[2-(1,3-thiazol-4-yl)ethyl]-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-3-[2-(1,3-thiazol-4-yl)ethyl]-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 63825689 |
| Molecular Formula | C11H9N3OS3 |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 2-sulfanylidene-3-[2-(1,3-thiazol-4-yl)ethyl]-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2[nH]c(=S)n1CCc1cscn1 |
| InChI | InChI=1S/C11H9N3OS3/c15-10-9-8(2-4-18-9)13-11(16)14(10)3-1-7-5-17-6-12-7/h2,4-6H,1,3H2,(H,13,16) |
| InChIKey | MNFDFZBLDZDPDW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|