C13H13N3OS3 — CID 63825516
5,6-dimethyl-2-sulfanylidene-3-[2-(1,3-thiazol-4-yl)ethyl]-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 63825516) has the molecular formula C13H13N3OS3 and a molecular weight of 323.47 g/mol. Its IUPAC name is 5,6-dimethyl-2-sulfanylidene-3-[2-(1,3-thiazol-4-yl)ethyl]-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-2-sulfanylidene-3-[2-(1,3-thiazol-4-yl)ethyl]-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 63825516 |
| Molecular Formula | C13H13N3OS3 |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 5,6-dimethyl-2-sulfanylidene-3-[2-(1,3-thiazol-4-yl)ethyl]-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2[nH]c(=S)n(CCc3cscn3)c(=O)c2c1C |
| InChI | InChI=1S/C13H13N3OS3/c1-7-8(2)20-11-10(7)12(17)16(13(18)15-11)4-3-9-5-19-6-14-9/h5-6H,3-4H2,1-2H3,(H,15,18) |
| InChIKey | LPRNHQJKOKCESQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|