C13H12N4OS2 — CID 106896934
5,6-dimethyl-3-(pyridazin-3-ylmethyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 106896934) has the molecular formula C13H12N4OS2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 5,6-dimethyl-3-(pyridazin-3-ylmethyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-3-(pyridazin-3-ylmethyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 106896934 |
| Molecular Formula | C13H12N4OS2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 5,6-dimethyl-3-(pyridazin-3-ylmethyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2[nH]c(=S)n(Cc3cccnn3)c(=O)c2c1C |
| InChI | InChI=1S/C13H12N4OS2/c1-7-8(2)20-11-10(7)12(18)17(13(19)15-11)6-9-4-3-5-14-16-9/h3-5H,6H2,1-2H3,(H,15,19) |
| InChIKey | BJKSQYDAKPIING-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|