C15H15N3O2S — CID 82342137
3-[(4-aminophenyl)methyl]-5,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 82342137) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-[(4-aminophenyl)methyl]-5,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-[(4-aminophenyl)methyl]-5,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 82342137 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-[(4-aminophenyl)methyl]-5,6-dimethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1sc2[nH]c(=O)n(Cc3ccc(N)cc3)c(=O)c2c1C |
| InChI | InChI=1S/C15H15N3O2S/c1-8-9(2)21-13-12(8)14(19)18(15(20)17-13)7-10-3-5-11(16)6-4-10/h3-6H,7,16H2,1-2H3,(H,17,20) |
| InChIKey | CBOTZYIWNIHGIO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|