C14H20N2OS2 — CID 64598410
3-(2,3-dimethylbutyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 64598410) has the molecular formula C14H20N2OS2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 3-(2,3-dimethylbutyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2,3-dimethylbutyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 64598410 |
| Molecular Formula | C14H20N2OS2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-(2,3-dimethylbutyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2[nH]c(=S)n(CC(C)C(C)C)c(=O)c2c1C |
| InChI | InChI=1S/C14H20N2OS2/c1-7(2)8(3)6-16-13(17)11-9(4)10(5)19-12(11)15-14(16)18/h7-8H,6H2,1-5H3,(H,15,18) |
| InChIKey | HJYGYUAQDOVNLO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|