C11H8N2OS3 — CID 63246577
2-sulfanylidene-3-(thiophen-3-ylmethyl)-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 63246577) has the molecular formula C11H8N2OS3 and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-sulfanylidene-3-(thiophen-3-ylmethyl)-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-3-(thiophen-3-ylmethyl)-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 63246577 |
| Molecular Formula | C11H8N2OS3 |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 2-sulfanylidene-3-(thiophen-3-ylmethyl)-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2[nH]c(=S)n1Cc1ccsc1 |
| InChI | InChI=1S/C11H8N2OS3/c14-10-9-8(2-4-17-9)12-11(15)13(10)5-7-1-3-16-6-7/h1-4,6H,5H2,(H,12,15) |
| InChIKey | IZQRZEHEJGVYNV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|