C13H10N2OS2 — CID 2117383
3-benzyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 2117383) has the molecular formula C13H10N2OS2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 3-benzyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2117383 |
| Molecular Formula | C13H10N2OS2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 3-benzyl-2-sulfanylidene-1H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1c2sccc2[nH]c(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C13H10N2OS2/c16-12-11-10(6-7-18-11)14-13(17)15(12)8-9-4-2-1-3-5-9/h1-7H,8H2,(H,14,17) |
| InChIKey | OPQCANYPSHWIDV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|