C29H33N3O2S2 — CID 3292192
6-[2-[(2,5-dimethylphenyl)methylsulfanyl]-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-[(4-methylphenyl)methyl]hexanamide (PubChem CID 3292192) has the molecular formula C29H33N3O2S2 and a molecular weight of 519.74 g/mol. Its IUPAC name is 6-[2-[(2,5-dimethylphenyl)methylsulfanyl]-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-[(4-methylphenyl)methyl]hexanamide.
| Compound Name | 6-[2-[(2,5-dimethylphenyl)methylsulfanyl]-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-[(4-methylphenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 3292192 |
| Molecular Formula | C29H33N3O2S2 |
| Molecular Weight | 519.74 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 6-[2-[(2,5-dimethylphenyl)methylsulfanyl]-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-[(4-methylphenyl)methyl]hexanamide |
| SMILES | Cc1ccc(CNC(=O)CCCCCn2c(SCc3cc(C)ccc3C)nc3ccsc3c2=O)cc1 |
| InChI | InChI=1S/C29H33N3O2S2/c1-20-9-12-23(13-10-20)18-30-26(33)7-5-4-6-15-32-28(34)27-25(14-16-35-27)31-29(32)36-19-24-17-21(2)8-11-22(24)3/h8-14,16-17H,4-7,15,18-19H2,1-3H3,(H,30,33) |
| InChIKey | GQRKIWOSSJHQQM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|