C16H9Cl2N3O5 — CID 18199873
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-chloro-2-nitrobenzoate (PubChem CID 18199873) has the molecular formula C16H9Cl2N3O5 and a molecular weight of 394.17 g/mol. Its IUPAC name is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-chloro-2-nitrobenzoate.
| Compound Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 18199873 |
| Molecular Formula | C16H9Cl2N3O5 |
| Molecular Weight | 394.17 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-chloro-2-nitrobenzoate |
| SMILES | O=C(OCc1cc(=O)n2cc(Cl)ccc2n1)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H9Cl2N3O5/c17-9-1-3-12(13(5-9)21(24)25)16(23)26-8-11-6-15(22)20-7-10(18)2-4-14(20)19-11/h1-7H,8H2 |
| InChIKey | YWSWSMTVSHZPII-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.17 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|