C24H12ClN3O7 — CID 55478912
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate (PubChem CID 55478912) has the molecular formula C24H12ClN3O7 and a molecular weight of 489.83 g/mol. Its IUPAC name is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 55478912 |
| Molecular Formula | C24H12ClN3O7 |
| Molecular Weight | 489.83 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1-nitro-9,10-dioxoanthracene-2-carboxylate |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc(C(=O)OCc1cc(=O)n3cc(Cl)ccc3n1)c2[N+](=O)[O-] |
| InChI | InChI=1S/C24H12ClN3O7/c25-12-5-8-18-26-13(9-19(29)27(18)10-12)11-35-24(32)17-7-6-16-20(21(17)28(33)34)23(31)15-4-2-1-3-14(15)22(16)30/h1-10H,11H2 |
| InChIKey | JQPYISJVAKACSB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 137.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|