About (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate (PubChem CID 46610857) has the molecular formula C18H12ClN3O3
and a molecular weight of 353.77 g/mol. Its IUPAC name is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate |
| PubChem CID | 46610857 |
| Molecular Formula | C18H12ClN3O3 |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate |
| SMILES | O=C(OCc1cc(=O)n2cc(Cl)ccc2n1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H12ClN3O3/c19-12-5-6-16-20-13(8-17(23)22(16)9-12)10-25-18(24)15-7-11-3-1-2-4-14(11)21-15/h1-9,21H,10H2 |
| InChIKey | IHBFUWAWFOOLBY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate?
The IUPAC name of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate (CID 46610857) is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate.
What is the SMILES notation for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate?
The canonical SMILES for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate is O=C(OCc1cc(=O)n2cc(Cl)ccc2n1)c1cc2ccccc2[nH]1.
What is the InChIKey of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate?
The InChIKey is IHBFUWAWFOOLBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClN3O3/c19-12-5-6-16-20-13(8-17(23)22(16)9-12)10-25-18(24)15-7-11-3-1-2-4-14(11)21-15/h1-9,21H,10H2.
What are the key properties of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate?
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate has a molecular weight of 353.77 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 1H-indole-2-carboxylate is sourced from PubChem (CID 46610857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).