C13H8N4O2S — CID 82055161
2-(6-nitro-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)acetonitrile (PubChem CID 82055161) has the molecular formula C13H8N4O2S and a molecular weight of 284.30 g/mol. Its IUPAC name is 2-(6-nitro-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)acetonitrile.
| Compound Name | 2-(6-nitro-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 82055161 |
| Molecular Formula | C13H8N4O2S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-(6-nitro-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)acetonitrile |
| SMILES | N#CCc1c(-c2cccs2)nc2ccc([N+](=O)[O-])cn12 |
| InChI | InChI=1S/C13H8N4O2S/c14-6-5-10-13(11-2-1-7-20-11)15-12-4-3-9(17(18)19)8-16(10)12/h1-4,7-8H,5H2 |
| InChIKey | JYMVVUNHAZNJCV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|