C13H9N5O2SSe — CID 137301649
5-[(4-nitrophenyl)diazenyl]-4-thiophen-2-yl-1,3-selenazol-2-amine (PubChem CID 137301649) has the molecular formula C13H9N5O2SSe and a molecular weight of 378.28 g/mol. Its IUPAC name is 5-[(4-nitrophenyl)diazenyl]-4-thiophen-2-yl-1,3-selenazol-2-amine.
| Compound Name | 5-[(4-nitrophenyl)diazenyl]-4-thiophen-2-yl-1,3-selenazol-2-amine |
|---|---|
| PubChem CID | 137301649 |
| Molecular Formula | C13H9N5O2SSe |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 5-[(4-nitrophenyl)diazenyl]-4-thiophen-2-yl-1,3-selenazol-2-amine |
| SMILES | Nc1nc(-c2cccs2)c(/N=N/c2ccc([N+](=O)[O-])cc2)[se]1 |
| InChI | InChI=1S/C13H9N5O2SSe/c14-13-15-11(10-2-1-7-21-10)12(22-13)17-16-8-3-5-9(6-4-8)18(19)20/h1-7H,(H2,14,15)/b17-16+ |
| InChIKey | ORYXVRYTLHJDEF-WUKNDPDISA-N |
| XLogP | 3.77 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|