C16H9N3O3S2 — CID 44721571
6-(4-nitrophenyl)-7-thiophen-2-yl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 44721571) has the molecular formula C16H9N3O3S2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-7-thiophen-2-yl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 6-(4-nitrophenyl)-7-thiophen-2-yl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 44721571 |
| Molecular Formula | C16H9N3O3S2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 6-(4-nitrophenyl)-7-thiophen-2-yl-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1c(-c2ccc([N+](=O)[O-])cc2)c(-c2cccs2)nc2sccn12 |
| InChI | InChI=1S/C16H9N3O3S2/c20-15-13(10-3-5-11(6-4-10)19(21)22)14(12-2-1-8-23-12)17-16-18(15)7-9-24-16/h1-9H |
| InChIKey | OVOQTFIBGWXVOZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|