C13H9ClN4SSe — CID 137301648
5-[(4-chlorophenyl)diazenyl]-4-thiophen-2-yl-1,3-selenazol-2-amine (PubChem CID 137301648) has the molecular formula C13H9ClN4SSe and a molecular weight of 367.72 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)diazenyl]-4-thiophen-2-yl-1,3-selenazol-2-amine.
| Compound Name | 5-[(4-chlorophenyl)diazenyl]-4-thiophen-2-yl-1,3-selenazol-2-amine |
|---|---|
| PubChem CID | 137301648 |
| Molecular Formula | C13H9ClN4SSe |
| Molecular Weight | 367.72 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | 5-[(4-chlorophenyl)diazenyl]-4-thiophen-2-yl-1,3-selenazol-2-amine |
| SMILES | Nc1nc(-c2cccs2)c(/N=N/c2ccc(Cl)cc2)[se]1 |
| InChI | InChI=1S/C13H9ClN4SSe/c14-8-3-5-9(6-4-8)17-18-12-11(16-13(15)20-12)10-2-1-7-19-10/h1-7H,(H2,15,16)/b18-17+ |
| InChIKey | XJFGNBAMBOLTKT-ISLYRVAYSA-N |
| XLogP | 4.52 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|