C11H6ClNOS — CID 13404237
5-chloro-3-thiophen-2-yl-1,2-benzoxazole (PubChem CID 13404237) has the molecular formula C11H6ClNOS and a molecular weight of 235.70 g/mol. Its IUPAC name is 5-chloro-3-thiophen-2-yl-1,2-benzoxazole.
| Compound Name | 5-chloro-3-thiophen-2-yl-1,2-benzoxazole |
|---|---|
| PubChem CID | 13404237 |
| Molecular Formula | C11H6ClNOS |
| Molecular Weight | 235.70 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | 5-chloro-3-thiophen-2-yl-1,2-benzoxazole |
| SMILES | Clc1ccc2onc(-c3cccs3)c2c1 |
| InChI | InChI=1S/C11H6ClNOS/c12-7-3-4-9-8(6-7)11(13-14-9)10-2-1-5-15-10/h1-6H |
| InChIKey | CFEADNJZDZGSIM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.70 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |