C10H5NO2S2 — CID 132919308
3-thiophen-2-ylthieno[2,3-e]oxazin-4-one (PubChem CID 132919308) has the molecular formula C10H5NO2S2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-thiophen-2-ylthieno[2,3-e]oxazin-4-one.
| Compound Name | 3-thiophen-2-ylthieno[2,3-e]oxazin-4-one |
|---|---|
| PubChem CID | 132919308 |
| Molecular Formula | C10H5NO2S2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 3-thiophen-2-ylthieno[2,3-e]oxazin-4-one |
| SMILES | O=c1c(-c2cccs2)noc2ccsc12 |
| InChI | InChI=1S/C10H5NO2S2/c12-9-8(7-2-1-4-14-7)11-13-6-3-5-15-10(6)9/h1-5H |
| InChIKey | LYEOIVSYIWTUKO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |