C12H9NO2S — CID 14097241
3-(3-methoxyphenyl)thieno[2,3-d][1,2]oxazole (PubChem CID 14097241) has the molecular formula C12H9NO2S and a molecular weight of 231.28 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)thieno[2,3-d][1,2]oxazole.
| Compound Name | 3-(3-methoxyphenyl)thieno[2,3-d][1,2]oxazole |
|---|---|
| PubChem CID | 14097241 |
| Molecular Formula | C12H9NO2S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 3-(3-methoxyphenyl)thieno[2,3-d][1,2]oxazole |
| SMILES | COc1cccc(-c2noc3ccsc23)c1 |
| InChI | InChI=1S/C12H9NO2S/c1-14-9-4-2-3-8(7-9)11-12-10(15-13-11)5-6-16-12/h2-7H,1H3 |
| InChIKey | AHCLVSYHPCMZDI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |