C22H18Cl2N2O3S — CID 71024267
(E)-2-[[(3,4-dichlorophenyl)methylamino]methyl]-3-(3-thieno[2,3-d][1,2]oxazol-3-ylphenoxy)prop-1-en-1-ol (PubChem CID 71024267) has the molecular formula C22H18Cl2N2O3S and a molecular weight of 461.37 g/mol. Its IUPAC name is (E)-2-[[(3,4-dichlorophenyl)methylamino]methyl]-3-(3-thieno[2,3-d][1,2]oxazol-3-ylphenoxy)prop-1-en-1-ol.
| Compound Name | (E)-2-[[(3,4-dichlorophenyl)methylamino]methyl]-3-(3-thieno[2,3-d][1,2]oxazol-3-ylphenoxy)prop-1-en-1-ol |
|---|---|
| PubChem CID | 71024267 |
| Molecular Formula | C22H18Cl2N2O3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | (E)-2-[[(3,4-dichlorophenyl)methylamino]methyl]-3-(3-thieno[2,3-d][1,2]oxazol-3-ylphenoxy)prop-1-en-1-ol |
| SMILES | O/C=C(\CNCc1ccc(Cl)c(Cl)c1)COc1cccc(-c2noc3ccsc23)c1 |
| InChI | InChI=1S/C22H18Cl2N2O3S/c23-18-5-4-14(8-19(18)24)10-25-11-15(12-27)13-28-17-3-1-2-16(9-17)21-22-20(29-26-21)6-7-30-22/h1-9,12,25,27H,10-11,13H2/b15-12+ |
| InChIKey | XFROQFPPOZGMIQ-NTCAYCPXSA-N |
| XLogP | 6.47 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|