C14H13NO3S — CID 142654196
3-(4-propan-2-ylperoxyphenyl)thieno[2,3-d][1,2]oxazole (PubChem CID 142654196) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 3-(4-propan-2-ylperoxyphenyl)thieno[2,3-d][1,2]oxazole.
| Compound Name | 3-(4-propan-2-ylperoxyphenyl)thieno[2,3-d][1,2]oxazole |
|---|---|
| PubChem CID | 142654196 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 3-(4-propan-2-ylperoxyphenyl)thieno[2,3-d][1,2]oxazole |
| SMILES | CC(C)OOc1ccc(-c2noc3ccsc23)cc1 |
| InChI | InChI=1S/C14H13NO3S/c1-9(2)17-18-11-5-3-10(4-6-11)13-14-12(16-15-13)7-8-19-14/h3-9H,1-2H3 |
| InChIKey | UYCFCZAYPKAGCV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|