C14H12N2O2 — CID 82105934
4-(6-methoxy-1,2-benzoxazol-3-yl)aniline (PubChem CID 82105934) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 4-(6-methoxy-1,2-benzoxazol-3-yl)aniline.
| Compound Name | 4-(6-methoxy-1,2-benzoxazol-3-yl)aniline |
|---|---|
| PubChem CID | 82105934 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 4-(6-methoxy-1,2-benzoxazol-3-yl)aniline |
| SMILES | COc1ccc2c(-c3ccc(N)cc3)noc2c1 |
| InChI | InChI=1S/C14H12N2O2/c1-17-11-6-7-12-13(8-11)18-16-14(12)9-2-4-10(15)5-3-9/h2-8H,15H2,1H3 |
| InChIKey | UDWMVHYOMGHKOO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|