C18H14F3N3O2 — CID 163740462
3-(6-methoxy-1,2-benzoxazol-3-yl)-2-methyl-N-(trifluoromethyl)-1H-indol-6-amine (PubChem CID 163740462) has the molecular formula C18H14F3N3O2 and a molecular weight of 361.32 g/mol. Its IUPAC name is 3-(6-methoxy-1,2-benzoxazol-3-yl)-2-methyl-N-(trifluoromethyl)-1H-indol-6-amine.
| Compound Name | 3-(6-methoxy-1,2-benzoxazol-3-yl)-2-methyl-N-(trifluoromethyl)-1H-indol-6-amine |
|---|---|
| PubChem CID | 163740462 |
| Molecular Formula | C18H14F3N3O2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 3-(6-methoxy-1,2-benzoxazol-3-yl)-2-methyl-N-(trifluoromethyl)-1H-indol-6-amine |
| SMILES | COc1ccc2c(-c3c(C)[nH]c4cc(NC(F)(F)F)ccc34)noc2c1 |
| InChI | InChI=1S/C18H14F3N3O2/c1-9-16(17-13-6-4-11(25-2)8-15(13)26-24-17)12-5-3-10(7-14(12)22-9)23-18(19,20)21/h3-8,22-23H,1-2H3 |
| InChIKey | LHGPZGVNJMMNQO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|