C13H17ClN2O2 — CID 52983604
6-methoxy-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride (PubChem CID 52983604) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 6-methoxy-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride.
| Compound Name | 6-methoxy-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride |
|---|---|
| PubChem CID | 52983604 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 6-methoxy-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride |
| SMILES | COc1ccc2c(C3CCNCC3)noc2c1.Cl |
| InChI | InChI=1S/C13H16N2O2.ClH/c1-16-10-2-3-11-12(8-10)17-15-13(11)9-4-6-14-7-5-9;/h2-3,8-9,14H,4-7H2,1H3;1H |
| InChIKey | FJDNMFKHBSBNDU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |