C14H17FN2O2 — CID 158743343
acetaldehyde;6-fluoro-3-piperidin-4-yl-1,2-benzoxazole (PubChem CID 158743343) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is acetaldehyde;6-fluoro-3-piperidin-4-yl-1,2-benzoxazole.
| Compound Name | acetaldehyde;6-fluoro-3-piperidin-4-yl-1,2-benzoxazole |
|---|---|
| PubChem CID | 158743343 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | acetaldehyde;6-fluoro-3-piperidin-4-yl-1,2-benzoxazole |
| SMILES | CC=O.Fc1ccc2c(C3CCNCC3)noc2c1 |
| InChI | InChI=1S/C12H13FN2O.C2H4O/c13-9-1-2-10-11(7-9)16-15-12(10)8-3-5-14-6-4-8;1-2-3/h1-2,7-8,14H,3-6H2;2H,1H3 |
| InChIKey | IMORYAKAHXCNHJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|