C13H10N2O2S — CID 718725
5-(4-methoxyphenyl)-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 718725) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(4-methoxyphenyl)-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 718725 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 5-(4-methoxyphenyl)-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2nc(-c3cccs3)no2)cc1 |
| InChI | InChI=1S/C13H10N2O2S/c1-16-10-6-4-9(5-7-10)13-14-12(15-17-13)11-3-2-8-18-11/h2-8H,1H3 |
| InChIKey | CSDXZWZBEXVREQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |