C12H10N4OS — CID 107811588
5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-diamine (PubChem CID 107811588) has the molecular formula C12H10N4OS and a molecular weight of 258.31 g/mol. Its IUPAC name is 5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-diamine.
| Compound Name | 5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 107811588 |
| Molecular Formula | C12H10N4OS |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 5-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(-c2nc(-c3cccs3)no2)c1 |
| InChI | InChI=1S/C12H10N4OS/c13-8-4-7(5-9(14)6-8)12-15-11(16-17-12)10-2-1-3-18-10/h1-6H,13-14H2 |
| InChIKey | GJLSATZVVBKTJQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|