C12H6Cl2N2OS — CID 718742
5-(2,4-dichlorophenyl)-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 718742) has the molecular formula C12H6Cl2N2OS and a molecular weight of 297.17 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(2,4-dichlorophenyl)-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 718742 |
| Molecular Formula | C12H6Cl2N2OS |
| Molecular Weight | 297.17 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | Clc1ccc(-c2nc(-c3cccs3)no2)c(Cl)c1 |
| InChI | InChI=1S/C12H6Cl2N2OS/c13-7-3-4-8(9(14)6-7)12-15-11(16-17-12)10-2-1-5-18-10/h1-6H |
| InChIKey | YPFOIBRKSQRTRK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.17 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |