C18H11FN2O2S — CID 53103359
3-[4-(4-fluorophenoxy)phenyl]-5-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 53103359) has the molecular formula C18H11FN2O2S and a molecular weight of 338.36 g/mol. Its IUPAC name is 3-[4-(4-fluorophenoxy)phenyl]-5-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-[4-(4-fluorophenoxy)phenyl]-5-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 53103359 |
| Molecular Formula | C18H11FN2O2S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 3-[4-(4-fluorophenoxy)phenyl]-5-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | Fc1ccc(Oc2ccc(-c3noc(-c4cccs4)n3)cc2)cc1 |
| InChI | InChI=1S/C18H11FN2O2S/c19-13-5-9-15(10-6-13)22-14-7-3-12(4-8-14)17-20-18(23-21-17)16-2-1-11-24-16/h1-11H |
| InChIKey | SCJOUFVMGPINKF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |