C16H15N3O3S2 — CID 53075191
3-(4-pyrrolidin-1-ylsulfonylphenyl)-5-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 53075191) has the molecular formula C16H15N3O3S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 3-(4-pyrrolidin-1-ylsulfonylphenyl)-5-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-(4-pyrrolidin-1-ylsulfonylphenyl)-5-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 53075191 |
| Molecular Formula | C16H15N3O3S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 3-(4-pyrrolidin-1-ylsulfonylphenyl)-5-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | O=S(=O)(c1ccc(-c2noc(-c3cccs3)n2)cc1)N1CCCC1 |
| InChI | InChI=1S/C16H15N3O3S2/c20-24(21,19-9-1-2-10-19)13-7-5-12(6-8-13)15-17-16(22-18-15)14-4-3-11-23-14/h3-8,11H,1-2,9-10H2 |
| InChIKey | RVHICEIEQCASNQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |