C17H13N3O3S — CID 3835386
3-(2,6-dimethoxyquinolin-3-yl)-5-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 3835386) has the molecular formula C17H13N3O3S and a molecular weight of 339.38 g/mol. Its IUPAC name is 3-(2,6-dimethoxyquinolin-3-yl)-5-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-(2,6-dimethoxyquinolin-3-yl)-5-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 3835386 |
| Molecular Formula | C17H13N3O3S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-(2,6-dimethoxyquinolin-3-yl)-5-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | COc1ccc2nc(OC)c(-c3noc(-c4cccs4)n3)cc2c1 |
| InChI | InChI=1S/C17H13N3O3S/c1-21-11-5-6-13-10(8-11)9-12(16(18-13)22-2)15-19-17(23-20-15)14-4-3-7-24-14/h3-9H,1-2H3 |
| InChIKey | CZZGRZQQHZMIKZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |