C23H20N2O5 — CID 174684949
bis[3-(3-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone (PubChem CID 174684949) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is bis[3-(3-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone.
| Compound Name | bis[3-(3-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone |
|---|---|
| PubChem CID | 174684949 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | bis[3-(3-methoxyphenyl)-5-methyl-1,2-oxazol-4-yl]methanone |
| SMILES | COc1cccc(-c2noc(C)c2C(=O)c2c(-c3cccc(OC)c3)noc2C)c1 |
| InChI | InChI=1S/C23H20N2O5/c1-13-19(21(24-29-13)15-7-5-9-17(11-15)27-3)23(26)20-14(2)30-25-22(20)16-8-6-10-18(12-16)28-4/h5-12H,1-4H3 |
| InChIKey | OZJSOASZOWSCJG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |