C18H15NO3 — CID 7901076
(3-methylphenyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 7901076) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is (3-methylphenyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | (3-methylphenyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 7901076 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | (3-methylphenyl) 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1cccc(OC(=O)c2c(-c3ccccc3)noc2C)c1 |
| InChI | InChI=1S/C18H15NO3/c1-12-7-6-10-15(11-12)21-18(20)16-13(2)22-19-17(16)14-8-4-3-5-9-14/h3-11H,1-2H3 |
| InChIKey | DGNVPEMOFHNMIF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|