C20H17NO5 — CID 42977015
2-benzoyloxyethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate (PubChem CID 42977015) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-benzoyloxyethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate.
| Compound Name | 2-benzoyloxyethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 42977015 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-benzoyloxyethyl 5-methyl-3-phenyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)OCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17NO5/c1-14-17(18(21-26-14)15-8-4-2-5-9-15)20(23)25-13-12-24-19(22)16-10-6-3-7-11-16/h2-11H,12-13H2,1H3 |
| InChIKey | SKVHEDLAFZKVLZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|